Thj2201 N-(5-hydroxypentyl) metabolite - dangerous good and controlled substance, CAS [[1850409-16-3]]
Catalog Number:
CBS-AZC40916
| Article Name: |
Thj2201 N-(5-hydroxypentyl) metabolite - dangerous good and controlled substance, CAS [[1850409-16-3]] |
| Biozol Catalog Number: |
CBS-AZC40916 |
| Supplier Catalog Number: |
AZC40916 |
| Alternative Catalog Number: |
CBS-AZC40916-5MG, CBS-AZC40916-10MG, CBS-AZC40916-25MG, CBS-AZC40916-50MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Molecular Weight: |
358.4 g/mol |
| Sequence: |
C1=CC=C2C(=C1)C=CC=C2C(=O)C3=NN(C4=CC=CC=C43)CCCCCO |
| CAS Number: |
[1850409-16-3] |
| Formula: |
C23H22N2O2 |